C22H31NO5 — CID 161495556
(E)-but-2-enedioic acid;[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanamine;hydrate (PubChem CID 161495556) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanamine;hydrate.
| Compound Name | (E)-but-2-enedioic acid;[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanamine;hydrate |
|---|---|
| PubChem CID | 161495556 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (E)-but-2-enedioic acid;[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanamine;hydrate |
| SMILES | NC[C@@]12CCC[C@H]1[C@@H]1CCc3ccccc3[C@H]1CC2.O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H25N.C4H4O4.H2O/c19-12-18-10-3-6-17(18)16-8-7-13-4-1-2-5-14(13)15(16)9-11-18;5-3(6)1-2-4(7)8;/h1-2,4-5,15-17H,3,6-12,19H2;1-2H,(H,5,6)(H,7,8);1H2/b;2-1+;/t15-,16-,17+,18+;;/m1../s1 |
| InChIKey | WGDOWWWYPHQNFV-DLJPHWSMSA-N |
| XLogP | 2.76 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|