C19H22F3NO3S — CID 67576515
(8R,9S,13R,14S)-13-[amino(trifluoromethylsulfonyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 67576515) has the molecular formula C19H22F3NO3S and a molecular weight of 401.45 g/mol. Its IUPAC name is (8R,9S,13R,14S)-13-[amino(trifluoromethylsulfonyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13R,14S)-13-[amino(trifluoromethylsulfonyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 67576515 |
| Molecular Formula | C19H22F3NO3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (8R,9S,13R,14S)-13-[amino(trifluoromethylsulfonyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | NC([C@]12CC[C@@H]3c4ccccc4CC[C@H]3[C@@H]1CCC2=O)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H22F3NO3S/c20-19(21,22)27(25,26)17(23)18-10-9-13-12-4-2-1-3-11(12)5-6-14(13)15(18)7-8-16(18)24/h1-4,13-15,17H,5-10,23H2/t13-,14-,15+,17?,18-/m1/s1 |
| InChIKey | AZGCKQVBAGYWFX-WKQDZWFFSA-N |
| XLogP | 3.31 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |