C21H28O2S — CID 142025321
4,6,17-trimethyl-4-sulfanyl-16-oxatetracyclo[9.8.0.02,8.012,17]nonadeca-2,5,7-trien-15-one (PubChem CID 142025321) has the molecular formula C21H28O2S and a molecular weight of 344.52 g/mol. Its IUPAC name is 4,6,17-trimethyl-4-sulfanyl-16-oxatetracyclo[9.8.0.02,8.012,17]nonadeca-2,5,7-trien-15-one.
| Compound Name | 4,6,17-trimethyl-4-sulfanyl-16-oxatetracyclo[9.8.0.02,8.012,17]nonadeca-2,5,7-trien-15-one |
|---|---|
| PubChem CID | 142025321 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4,6,17-trimethyl-4-sulfanyl-16-oxatetracyclo[9.8.0.02,8.012,17]nonadeca-2,5,7-trien-15-one |
| SMILES | CC1=CC(C)(S)C=C2C(=C1)CCC1C2CCC2(C)OC(=O)CCC12 |
| InChI | InChI=1S/C21H28O2S/c1-13-10-14-4-5-16-15(17(14)12-20(2,24)11-13)8-9-21(3)18(16)6-7-19(22)23-21/h10-12,15-16,18,24H,4-9H2,1-3H3 |
| InChIKey | NDIBFIAZNJBYQP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|