C18H25O5P — CID 70357100
[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid (PubChem CID 70357100) has the molecular formula C18H25O5P and a molecular weight of 352.37 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid.
| Compound Name | [(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 70357100 |
| Molecular Formula | C18H25O5P |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-2,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid |
| SMILES | C[C@]12CC[C@@H]3C4=CCC(O)(P(=O)(O)O)C=C4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H25O5P/c1-17-8-6-13-12-7-9-18(20,24(21,22)23)10-11(12)2-3-14(13)15(17)4-5-16(17)19/h7,10,13-15,20H,2-6,8-9H2,1H3,(H2,21,22,23)/t13-,14-,15+,17+,18?/m1/s1 |
| InChIKey | GCDUNRZVBJJFHX-ITZGOJCESA-N |
| XLogP | 2.91 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|