C21H27BrO4 — CID 5176542
17-acetyl-4-bromo-16,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 5176542) has the molecular formula C21H27BrO4 and a molecular weight of 423.35 g/mol. Its IUPAC name is 17-acetyl-4-bromo-16,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-acetyl-4-bromo-16,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 5176542 |
| Molecular Formula | C21H27BrO4 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 17-acetyl-4-bromo-16,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)C1(O)C(O)CC2C3CCC4=C(Br)C(=O)C=CC4(C)C3CCC21C |
| InChI | InChI=1S/C21H27BrO4/c1-11(23)21(26)17(25)10-15-12-4-5-14-18(22)16(24)7-8-19(14,2)13(12)6-9-20(15,21)3/h7-8,12-13,15,17,25-26H,4-6,9-10H2,1-3H3 |
| InChIKey | YYWFIVRMMPQXKU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|