C21H27F5O3 — CID 91603838
(1S,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-15-(1,1,2,2,2-pentafluoroethyl)-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one (PubChem CID 91603838) has the molecular formula C21H27F5O3 and a molecular weight of 422.43 g/mol. Its IUPAC name is (1S,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-15-(1,1,2,2,2-pentafluoroethyl)-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one.
| Compound Name | (1S,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-15-(1,1,2,2,2-pentafluoroethyl)-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one |
|---|---|
| PubChem CID | 91603838 |
| Molecular Formula | C21H27F5O3 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (1S,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-15-(1,1,2,2,2-pentafluoroethyl)-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC45OC4C(=O)CC[C@]35C)[C@@H]1CCC2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H27F5O3/c1-16-8-6-14(27)15-18(16,29-15)9-3-11-12(16)4-7-17(2)13(11)5-10-19(17,28)20(22,23)21(24,25)26/h11-13,15,28H,3-10H2,1-2H3/t11-,12+,13+,15?,16-,17+,18?,19?/m1/s1 |
| InChIKey | YMZVIUZAMILBID-HFIRICQJSA-N |
| XLogP | 4.66 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|