C19H26O3 — CID 154792934
(2R,6S,8S,16S)-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione (PubChem CID 154792934) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (2R,6S,8S,16S)-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione.
| Compound Name | (2R,6S,8S,16S)-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
|---|---|
| PubChem CID | 154792934 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2R,6S,8S,16S)-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
| SMILES | C[C@]12CCC3C(CC[C@@]45O[C@@H]4C(=O)CC[C@]35C)C1CCC2=O |
| InChI | InChI=1S/C19H26O3/c1-17-8-6-13-11(12(17)3-4-15(17)21)5-10-19-16(22-19)14(20)7-9-18(13,19)2/h11-13,16H,3-10H2,1-2H3/t11?,12?,13?,16-,17+,18-,19-/m1/s1 |
| InChIKey | LIMBPOMDHZQBJH-BYJZKUQESA-N |
| XLogP | 3.30 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|