C18H22O5 — CID 10403586
(1S,2R,3R,5S,7R,9S,12S,13S,17S)-2-hydroxy-17-methyl-4,8-dioxahexacyclo[10.7.0.02,9.03,5.07,9.013,17]nonadecane-6,16-dione (PubChem CID 10403586) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (1S,2R,3R,5S,7R,9S,12S,13S,17S)-2-hydroxy-17-methyl-4,8-dioxahexacyclo[10.7.0.02,9.03,5.07,9.013,17]nonadecane-6,16-dione.
| Compound Name | (1S,2R,3R,5S,7R,9S,12S,13S,17S)-2-hydroxy-17-methyl-4,8-dioxahexacyclo[10.7.0.02,9.03,5.07,9.013,17]nonadecane-6,16-dione |
|---|---|
| PubChem CID | 10403586 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (1S,2R,3R,5S,7R,9S,12S,13S,17S)-2-hydroxy-17-methyl-4,8-dioxahexacyclo[10.7.0.02,9.03,5.07,9.013,17]nonadecane-6,16-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@]45O[C@H]4C(=O)[C@H]4O[C@H]4[C@]35O)[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H22O5/c1-16-6-5-10-8(9(16)2-3-11(16)19)4-7-17-14(23-17)12(20)13-15(22-13)18(10,17)21/h8-10,13-15,21H,2-7H2,1H3/t8-,9-,10-,13+,14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | WRJUMUPFNVUKPZ-JHAKWAGASA-N |
| XLogP | 1.01 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|