C23H32O5 — CID 10960075
[2-[(1S,2R,6S,8S,11S,12S,15S,16S)-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-oxoethyl] acetate (PubChem CID 10960075) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [2-[(1S,2R,6S,8S,11S,12S,15S,16S)-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1S,2R,6S,8S,11S,12S,15S,16S)-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 10960075 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [2-[(1S,2R,6S,8S,11S,12S,15S,16S)-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@]45O[C@@H]4C(=O)CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H32O5/c1-13(24)27-12-19(26)17-5-4-15-14-6-11-23-20(28-23)18(25)8-10-22(23,3)16(14)7-9-21(15,17)2/h14-17,20H,4-12H2,1-3H3/t14-,15-,16-,17+,20+,21-,22+,23+/m0/s1 |
| InChIKey | IGGMGGVIRMXDSV-BFCQFXIVSA-N |
| XLogP | 3.48 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|