C24H36O5 — CID 57200322
3-[(1R,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]propyl acetate (PubChem CID 57200322) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is 3-[(1R,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]propyl acetate.
| Compound Name | 3-[(1R,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]propyl acetate |
|---|---|
| PubChem CID | 57200322 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 3-[(1R,2R,11S,12S,16S)-15-hydroxy-2,16-dimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]propyl acetate |
| SMILES | CC(=O)OCCCC1(O)CC[C@H]2[C@@H]3CCC45OC4C(=O)CC[C@]5(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H36O5/c1-15(25)28-14-4-9-23(27)12-7-17-16-5-13-24-20(29-24)19(26)8-11-22(24,3)18(16)6-10-21(17,23)2/h16-18,20,27H,4-14H2,1-3H3/t16-,17-,18+,20?,21-,22+,23?,24?/m0/s1 |
| InChIKey | PCKDZMIMWJITPI-NXSNEMNKSA-N |
| XLogP | 3.80 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|