C23H37ClO3 — CID 154182423
2-[(8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate (PubChem CID 154182423) has the molecular formula C23H37ClO3 and a molecular weight of 397.00 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate.
| Compound Name | 2-[(8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate |
|---|---|
| PubChem CID | 154182423 |
| Molecular Formula | C23H37ClO3 |
| Molecular Weight | 397.00 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@]1(O)CC[C@H]2[C@@H]3CCC4C(Cl)CCC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H37ClO3/c1-15(25)27-14-13-23(26)12-9-18-16-6-7-19-20(24)5-4-10-21(19,2)17(16)8-11-22(18,23)3/h16-20,26H,4-14H2,1-3H3/t16-,17+,18+,19?,20?,21-,22+,23+/m1/s1 |
| InChIKey | RRGBOGZFPOJCEC-XAQLXDLTSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.00 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|