C19H25FO4 — CID 88841846
(1S,2S,11S,12S,16S)-1-fluoro-18-hydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione (PubChem CID 88841846) has the molecular formula C19H25FO4 and a molecular weight of 336.40 g/mol. Its IUPAC name is (1S,2S,11S,12S,16S)-1-fluoro-18-hydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione.
| Compound Name | (1S,2S,11S,12S,16S)-1-fluoro-18-hydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
|---|---|
| PubChem CID | 88841846 |
| Molecular Formula | C19H25FO4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (1S,2S,11S,12S,16S)-1-fluoro-18-hydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
| SMILES | C[C@]12CCC(=O)C3OC31CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)CC(O)[C@]12F |
| InChI | InChI=1S/C19H25FO4/c1-16-9-14(23)19(20)11(10(16)3-4-13(16)22)5-8-18-15(24-18)12(21)6-7-17(18,19)2/h10-11,14-15,23H,3-9H2,1-2H3/t10-,11-,14?,15?,16-,17-,18?,19+/m0/s1 |
| InChIKey | KDSMZDWBKDULJE-RDLCTSKSSA-N |
| XLogP | 2.36 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|