C19H28O3 — CID 74765910
(1S,2S,5S,7S,10S,11S,15S,17S)-5-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-14-one (PubChem CID 74765910) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,2S,5S,7S,10S,11S,15S,17S)-5-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-14-one.
| Compound Name | (1S,2S,5S,7S,10S,11S,15S,17S)-5-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-14-one |
|---|---|
| PubChem CID | 74765910 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,2S,5S,7S,10S,11S,15S,17S)-5-hydroxy-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-14-one |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)C[C@@H]3O[C@@]312 |
| InChI | InChI=1S/C19H28O3/c1-17-10-16-19(22-16)14(13(17)5-6-15(17)21)4-3-11-9-12(20)7-8-18(11,19)2/h11-14,16,20H,3-10H2,1-2H3/t11-,12-,13-,14-,16-,17-,18-,19+/m0/s1 |
| InChIKey | HHMJOWWFESEVCR-KFXHTDORSA-N |
| XLogP | 3.09 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|