C20H30O2 — CID 11243586
(1S,2R,5R,7S,9S,11R,12S,16S)-5-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-one (PubChem CID 11243586) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,2R,5R,7S,9S,11R,12S,16S)-5-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-one.
| Compound Name | (1S,2R,5R,7S,9S,11R,12S,16S)-5-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-one |
|---|---|
| PubChem CID | 11243586 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,2R,5R,7S,9S,11R,12S,16S)-5-hydroxy-2,16-dimethylpentacyclo[9.7.0.02,7.07,9.012,16]octadecan-15-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](C[C@H]4C[C@]45C[C@H](O)CC[C@]35C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C20H30O2/c1-18-7-6-16-14(15(18)3-4-17(18)22)9-12-10-20(12)11-13(21)5-8-19(16,20)2/h12-16,21H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,18-,19+,20-/m0/s1 |
| InChIKey | PSFIQYPDVBZBLR-SQZIYUPFSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |