C20H30O — CID 132523878
(4R,5S,9S,12S,13R)-9,13-dimethylpentacyclo[14.1.1.01,13.04,12.05,9]octadecan-8-one (PubChem CID 132523878) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (4R,5S,9S,12S,13R)-9,13-dimethylpentacyclo[14.1.1.01,13.04,12.05,9]octadecan-8-one.
| Compound Name | (4R,5S,9S,12S,13R)-9,13-dimethylpentacyclo[14.1.1.01,13.04,12.05,9]octadecan-8-one |
|---|---|
| PubChem CID | 132523878 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (4R,5S,9S,12S,13R)-9,13-dimethylpentacyclo[14.1.1.01,13.04,12.05,9]octadecan-8-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC45CC(CC[C@]34C)C5)[C@@H]1CCC2=O |
| InChI | InChI=1S/C20H30O/c1-18-8-7-16-14(15(18)3-4-17(18)21)6-10-20-11-13(12-20)5-9-19(16,20)2/h13-16H,3-12H2,1-2H3/t13?,14-,15-,16-,18-,19+,20?/m0/s1 |
| InChIKey | UUCKUTQTZAVFLJ-DZRLGSOUSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |