C22H29FO3 — CID 57182762
(1S,2R,3R,10S,11R,12S,16S)-9-(fluoromethylidene)-2,3,10,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione (PubChem CID 57182762) has the molecular formula C22H29FO3 and a molecular weight of 360.47 g/mol. Its IUPAC name is (1S,2R,3R,10S,11R,12S,16S)-9-(fluoromethylidene)-2,3,10,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione.
| Compound Name | (1S,2R,3R,10S,11R,12S,16S)-9-(fluoromethylidene)-2,3,10,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
|---|---|
| PubChem CID | 57182762 |
| Molecular Formula | C22H29FO3 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (1S,2R,3R,10S,11R,12S,16S)-9-(fluoromethylidene)-2,3,10,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
| SMILES | C[C@@H]1C(=CF)C23OC2C(=O)C[C@@H](C)[C@]3(C)[C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C22H29FO3/c1-11-9-16(24)19-22(26-19)15(10-23)12(2)18-13-5-6-17(25)20(13,3)8-7-14(18)21(11,22)4/h10-14,18-19H,5-9H2,1-4H3/t11-,12-,13+,14+,18+,19?,20+,21-,22?/m1/s1 |
| InChIKey | BUSOYPCOGXMUAP-OTKADUFVSA-N |
| XLogP | 4.25 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|