C21H27FO3 — CID 88624506
(1S,2R,3R,11R,12S,14R,16S)-14-fluoro-2,3,16-trimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione (PubChem CID 88624506) has the molecular formula C21H27FO3 and a molecular weight of 346.44 g/mol. Its IUPAC name is (1S,2R,3R,11R,12S,14R,16S)-14-fluoro-2,3,16-trimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione.
| Compound Name | (1S,2R,3R,11R,12S,14R,16S)-14-fluoro-2,3,16-trimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
|---|---|
| PubChem CID | 88624506 |
| Molecular Formula | C21H27FO3 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (1S,2R,3R,11R,12S,14R,16S)-14-fluoro-2,3,16-trimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,15-dione |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@]3(C)C(=O)[C@H](F)C[C@@H]23)[C@@]2(C)[C@H](C)CC(=O)C3OC132 |
| InChI | InChI=1S/C21H27FO3/c1-10-8-16(23)18-21(25-18)11(2)7-12-13(20(10,21)4)5-6-19(3)14(12)9-15(22)17(19)24/h10,12-15,18H,2,5-9H2,1,3-4H3/t10-,12-,13+,14+,15-,18?,19+,20-,21?/m1/s1 |
| InChIKey | KVVXUGOEJPMMGK-RWKZCVHXSA-N |
| XLogP | 3.66 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|