C20H23FO3 — CID 88624568
(1S,2R,11R,12S,14S,16S)-14-fluoro-2,16-dimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-ene-5,15-dione (PubChem CID 88624568) has the molecular formula C20H23FO3 and a molecular weight of 330.40 g/mol. Its IUPAC name is (1S,2R,11R,12S,14S,16S)-14-fluoro-2,16-dimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-ene-5,15-dione.
| Compound Name | (1S,2R,11R,12S,14S,16S)-14-fluoro-2,16-dimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-ene-5,15-dione |
|---|---|
| PubChem CID | 88624568 |
| Molecular Formula | C20H23FO3 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (1S,2R,11R,12S,14S,16S)-14-fluoro-2,16-dimethyl-9-methylidene-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-ene-5,15-dione |
| SMILES | C=C1C[C@H]2[C@@H]3C[C@H](F)C(=O)[C@@]3(C)CC[C@@H]2[C@@]2(C)C=CC(=O)C3OC132 |
| InChI | InChI=1S/C20H23FO3/c1-10-8-11-12(4-6-18(2)13(11)9-14(21)16(18)23)19(3)7-5-15(22)17-20(10,19)24-17/h5,7,11-14,17H,1,4,6,8-9H2,2-3H3/t11-,12+,13+,14+,17?,18+,19-,20?/m1/s1 |
| InChIKey | MRWZKGNIFOPXKF-GVBLJUNYSA-N |
| XLogP | 3.19 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|