C22H27FO3S — CID 88624534
S-[(8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] ethanethioate (PubChem CID 88624534) has the molecular formula C22H27FO3S and a molecular weight of 390.52 g/mol. Its IUPAC name is S-[(8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] ethanethioate.
| Compound Name | S-[(8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] ethanethioate |
|---|---|
| PubChem CID | 88624534 |
| Molecular Formula | C22H27FO3S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | S-[(8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] ethanethioate |
| SMILES | C=C1C[C@@H]2[C@@H](CC[C@]3(C)C(=O)C(F)C[C@@H]23)[C@@]2(C)CCC(=O)C(SC(C)=O)=C12 |
| InChI | InChI=1S/C22H27FO3S/c1-11-9-13-14(5-7-22(4)15(13)10-16(23)20(22)26)21(3)8-6-17(25)19(18(11)21)27-12(2)24/h13-16H,1,5-10H2,2-4H3/t13-,14-,15+,16?,21-,22+/m1/s1 |
| InChIKey | SQWLUCADABZKJZ-SGIFPOSLSA-N |
| XLogP | 4.81 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|