C22H25FO4 — CID 70386462
[(8R,9S,10R,13S,14S,16S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate (PubChem CID 70386462) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,16S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,16S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 70386462 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [(8R,9S,10R,13S,14S,16S)-16-fluoro-10,13-dimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@]3(C)C(=O)[C@@H](F)C[C@@H]23)[C@@]2(C)C=CC(=O)C(OC(C)=O)=C12 |
| InChI | InChI=1S/C22H25FO4/c1-11-9-13-14(5-7-22(4)15(13)10-16(23)20(22)26)21(3)8-6-17(25)19(18(11)21)27-12(2)24/h6,8,13-16H,1,5,7,9-10H2,2-4H3/t13-,14+,15+,16+,21-,22+/m1/s1 |
| InChIKey | LIQZCVYAORUMKN-NZYONPFJSA-N |
| XLogP | 3.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |