C21H24ClFO2 — CID 18632009
(8R,9S,10R,13S,14S)-4-chloro-16-fluoro-7,10,13-trimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 18632009) has the molecular formula C21H24ClFO2 and a molecular weight of 362.87 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-4-chloro-16-fluoro-7,10,13-trimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-4-chloro-16-fluoro-7,10,13-trimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 18632009 |
| Molecular Formula | C21H24ClFO2 |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (8R,9S,10R,13S,14S)-4-chloro-16-fluoro-7,10,13-trimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1C2=C(Cl)C(=O)C=C[C@]2(C)[C@H]2CC[C@]3(C)C(=O)C(F)C[C@H]3[C@@H]2C1C |
| InChI | InChI=1S/C21H24ClFO2/c1-10-11(2)17-18(22)15(24)6-8-20(17,3)12-5-7-21(4)13(16(10)12)9-14(23)19(21)25/h6,8,10,12-14,16H,2,5,7,9H2,1,3-4H3/t10?,12-,13-,14?,16+,20+,21-/m0/s1 |
| InChIKey | UYZKKZCVZNFCDS-UHAUOFICSA-N |
| XLogP | 4.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|