C23H27FO4 — CID 70386740
[(7S,8R,9S,10R,13S,14S,16S)-16-fluoro-7,10,13-trimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate (PubChem CID 70386740) has the molecular formula C23H27FO4 and a molecular weight of 386.46 g/mol. Its IUPAC name is [(7S,8R,9S,10R,13S,14S,16S)-16-fluoro-7,10,13-trimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate.
| Compound Name | [(7S,8R,9S,10R,13S,14S,16S)-16-fluoro-7,10,13-trimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 70386740 |
| Molecular Formula | C23H27FO4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [(7S,8R,9S,10R,13S,14S,16S)-16-fluoro-7,10,13-trimethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
| SMILES | C=C1C2=C(OC(C)=O)C(=O)C=C[C@]2(C)[C@H]2CC[C@]3(C)C(=O)[C@@H](F)C[C@H]3[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C23H27FO4/c1-11-12(2)19-20(28-13(3)25)17(26)7-9-22(19,4)14-6-8-23(5)15(18(11)14)10-16(24)21(23)27/h7,9,11,14-16,18H,2,6,8,10H2,1,3-5H3/t11-,14+,15+,16+,18-,22-,23+/m1/s1 |
| InChIKey | YMQYIOSWOLNFQI-KYOFZDOTSA-N |
| XLogP | 4.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |