C20H22F2O2 — CID 18632048
(8R,9S,10R,13S,14S)-4,16-difluoro-10,13-dimethyl-7-methylidene-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 18632048) has the molecular formula C20H22F2O2 and a molecular weight of 332.39 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-4,16-difluoro-10,13-dimethyl-7-methylidene-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-4,16-difluoro-10,13-dimethyl-7-methylidene-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 18632048 |
| Molecular Formula | C20H22F2O2 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (8R,9S,10R,13S,14S)-4,16-difluoro-10,13-dimethyl-7-methylidene-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1CC2=C(F)C(=O)C=C[C@]2(C)[C@H]2CC[C@]3(C)C(=O)C(F)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H22F2O2/c1-10-8-13-17(22)15(23)5-7-19(13,2)11-4-6-20(3)12(16(10)11)9-14(21)18(20)24/h5,7,11-12,14,16H,1,4,6,8-9H2,2-3H3/t11-,12-,14?,16+,19+,20-/m0/s1 |
| InChIKey | ONOITRYNZXBDKJ-XBSNJQSHSA-N |
| XLogP | 4.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|