C19H27FO2 — CID 139407638
(1R,2R,5S,8S,11R,12S,14R,16S)-14-fluoro-5-hydroxy-16-methylpentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one (PubChem CID 139407638) has the molecular formula C19H27FO2 and a molecular weight of 306.42 g/mol. Its IUPAC name is (1R,2R,5S,8S,11R,12S,14R,16S)-14-fluoro-5-hydroxy-16-methylpentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one.
| Compound Name | (1R,2R,5S,8S,11R,12S,14R,16S)-14-fluoro-5-hydroxy-16-methylpentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one |
|---|---|
| PubChem CID | 139407638 |
| Molecular Formula | C19H27FO2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (1R,2R,5S,8S,11R,12S,14R,16S)-14-fluoro-5-hydroxy-16-methylpentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one |
| SMILES | C[C@]12CC[C@@H]3[C@H]4CC[C@]5(O)CC5[C@H]4CC[C@H]3[C@@H]1C[C@@H](F)C2=O |
| InChI | InChI=1S/C19H27FO2/c1-18-6-4-10-11-5-7-19(22)9-15(19)13(11)3-2-12(10)14(18)8-16(20)17(18)21/h10-16,22H,2-9H2,1H3/t10-,11-,12-,13+,14+,15?,16-,18+,19+/m1/s1 |
| InChIKey | HPAHAZXCWOGUJV-TYSMOLSMSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |