C23H30O4 — CID 57063288
[(8R,9R,10R,13S,14S)-7,10,13-trimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] acetate (PubChem CID 57063288) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-7,10,13-trimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] acetate.
| Compound Name | [(8R,9R,10R,13S,14S)-7,10,13-trimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 57063288 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-7,10,13-trimethyl-6-methylidene-3,17-dioxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-yl] acetate |
| SMILES | C=C1C2=C(OC(C)=O)C(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@@H]2C1C |
| InChI | InChI=1S/C23H30O4/c1-12-13(2)20-21(27-14(3)24)17(25)9-11-23(20,5)16-8-10-22(4)15(19(12)16)6-7-18(22)26/h12,15-16,19H,2,6-11H2,1,3-5H3/t12?,15-,16+,19-,22-,23+/m0/s1 |
| InChIKey | QXIZZDBATQMDQT-SXACLSNBSA-N |
| XLogP | 4.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |