C23H30O3 — CID 18631871
(7S,8R,9S,10S,13S,14S)-4-methoxy-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 18631871) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (7S,8R,9S,10S,13S,14S)-4-methoxy-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7S,8R,9S,10S,13S,14S)-4-methoxy-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 18631871 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (7S,8R,9S,10S,13S,14S)-4-methoxy-1,7,10,13-tetramethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1C2=C(OC)C(=O)C=C(C)[C@]2(C)[C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C23H30O3/c1-12-11-17(24)21(26-6)20-14(3)13(2)19-15-7-8-18(25)22(15,4)10-9-16(19)23(12,20)5/h11,13,15-16,19H,3,7-10H2,1-2,4-6H3/t13-,15+,16+,19+,22+,23-/m1/s1 |
| InChIKey | MAVSDTSEDQQFSV-BECSTCAASA-N |
| XLogP | 4.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |