C19H25NO2 — CID 10086122
(1R,2S,4R,10R,11S,14S,18S)-10,14-dimethyl-3-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione (PubChem CID 10086122) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R,2S,4R,10R,11S,14S,18S)-10,14-dimethyl-3-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione.
| Compound Name | (1R,2S,4R,10R,11S,14S,18S)-10,14-dimethyl-3-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione |
|---|---|
| PubChem CID | 10086122 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,2S,4R,10R,11S,14S,18S)-10,14-dimethyl-3-azapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione |
| SMILES | C[C@]12CCC(=O)C=C1[C@H]1N[C@H]1[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H25NO2/c1-18-7-5-10(21)9-13(18)16-17(20-16)15-11-3-4-14(22)19(11,2)8-6-12(15)18/h9,11-12,15-17,20H,3-8H2,1-2H3/t11-,12-,15-,16+,17-,18+,19-/m0/s1 |
| InChIKey | RHTKJKHMCSMPIQ-OZWALMNPSA-N |
| XLogP | 2.65 |
| TPSA | 56.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|