C20H24F2O2 — CID 171343487
(1R,10R,11S,14S,18S)-3,3-difluoro-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione (PubChem CID 171343487) has the molecular formula C20H24F2O2 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1R,10R,11S,14S,18S)-3,3-difluoro-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione.
| Compound Name | (1R,10R,11S,14S,18S)-3,3-difluoro-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione |
|---|---|
| PubChem CID | 171343487 |
| Molecular Formula | C20H24F2O2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1R,10R,11S,14S,18S)-3,3-difluoro-10,14-dimethylpentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene-7,15-dione |
| SMILES | C[C@]12CCC(=O)C=C1C1C([C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1(F)F |
| InChI | InChI=1S/C20H24F2O2/c1-18-7-5-10(23)9-13(18)16-17(20(16,21)22)15-11-3-4-14(24)19(11,2)8-6-12(15)18/h9,11-12,15-17H,3-8H2,1-2H3/t11-,12-,15-,16?,17?,18+,19-/m0/s1 |
| InChIKey | JTGATAHQDSEPQD-ZDAPDXHPSA-N |
| XLogP | 4.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |