C27H38O2 — CID 126763583
(3'R,5'S,7'S,11'R,17'R,18'R)-7',11',17',18'-tetramethylspiro[cyclohexane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-1,14'-dione (PubChem CID 126763583) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is (3'R,5'S,7'S,11'R,17'R,18'R)-7',11',17',18'-tetramethylspiro[cyclohexane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-1,14'-dione.
| Compound Name | (3'R,5'S,7'S,11'R,17'R,18'R)-7',11',17',18'-tetramethylspiro[cyclohexane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-1,14'-dione |
|---|---|
| PubChem CID | 126763583 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (3'R,5'S,7'S,11'R,17'R,18'R)-7',11',17',18'-tetramethylspiro[cyclohexane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-1,14'-dione |
| SMILES | CC1C2C(CC[C@@]3(C)C2C2C[C@@H]2C32CCC(=O)CC2)[C@@]2(C)CCC(=O)C=C2[C@@H]1C |
| InChI | InChI=1S/C27H38O2/c1-15-16(2)23-20(25(3)9-5-18(29)13-21(15)25)8-10-26(4)24(23)19-14-22(19)27(26)11-6-17(28)7-12-27/h13,15-16,19-20,22-24H,5-12,14H2,1-4H3/t15-,16?,19?,20?,22+,23?,24?,25-,26+/m1/s1 |
| InChIKey | VSVVETSBOXSFJG-SQUXYXKRSA-N |
| XLogP | 6.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |