C24H29FO4 — CID 70386225
[(7S,8R,9S,10S,13S,14S,16S)-16-fluoro-1,7,10,13-tetramethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate (PubChem CID 70386225) has the molecular formula C24H29FO4 and a molecular weight of 400.49 g/mol. Its IUPAC name is [(7S,8R,9S,10S,13S,14S,16S)-16-fluoro-1,7,10,13-tetramethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate.
| Compound Name | [(7S,8R,9S,10S,13S,14S,16S)-16-fluoro-1,7,10,13-tetramethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 70386225 |
| Molecular Formula | C24H29FO4 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [(7S,8R,9S,10S,13S,14S,16S)-16-fluoro-1,7,10,13-tetramethyl-6-methylidene-3,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
| SMILES | C=C1C2=C(OC(C)=O)C(=O)C=C(C)[C@]2(C)[C@H]2CC[C@]3(C)C(=O)[C@@H](F)C[C@H]3[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C24H29FO4/c1-11-9-18(27)21(29-14(4)26)20-13(3)12(2)19-15(24(11,20)6)7-8-23(5)16(19)10-17(25)22(23)28/h9,12,15-17,19H,3,7-8,10H2,1-2,4-6H3/t12-,15+,16+,17+,19-,23+,24-/m1/s1 |
| InChIKey | YFWBWOCQQRPCLO-JKKWDSBCSA-N |
| XLogP | 4.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |