C22H27FO2 — CID 57205344
(7S,8R,9S,10S,13S,14S)-6-(fluoromethylidene)-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57205344) has the molecular formula C22H27FO2 and a molecular weight of 342.45 g/mol. Its IUPAC name is (7S,8R,9S,10S,13S,14S)-6-(fluoromethylidene)-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7S,8R,9S,10S,13S,14S)-6-(fluoromethylidene)-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57205344 |
| Molecular Formula | C22H27FO2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (7S,8R,9S,10S,13S,14S)-6-(fluoromethylidene)-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC1=CC(=O)C=C2C(=CF)[C@@H](C)[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]12C |
| InChI | InChI=1S/C22H27FO2/c1-12-9-14(24)10-18-15(11-23)13(2)20-16-5-6-19(25)21(16,3)8-7-17(20)22(12,18)4/h9-11,13,16-17,20H,5-8H2,1-4H3/t13-,16+,17+,20+,21+,22-/m1/s1 |
| InChIKey | IFKRMKUSEZCLTI-IRLJCBSGSA-N |
| XLogP | 4.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |