C22H28FNO2 — CID 57180790
(7S,8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57180790) has the molecular formula C22H28FNO2 and a molecular weight of 357.47 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7S,8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57180790 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S)-6-(fluoromethylidene)-4-imino-1,7,10,13-tetramethyl-7,8,9,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | [H]/N=C1\C(=O)C=C(C)[C@@]2(C)C1C(=CF)[C@@H](C)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H28FNO2/c1-11-9-16(25)20(24)19-13(10-23)12(2)18-14-5-6-17(26)21(14,3)8-7-15(18)22(11,19)4/h9-10,12,14-15,18-19,24H,5-8H2,1-4H3/b13-10?,24-20+/t12-,14+,15+,18+,19?,21+,22-/m1/s1 |
| InChIKey | LDTZXMAQVNCGKP-HYRMORKYSA-N |
| XLogP | 4.67 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|