C22H28O2S — CID 18631885
(8R,9S,10R,13S,14S)-4-ethylsulfanyl-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 18631885) has the molecular formula C22H28O2S and a molecular weight of 356.53 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-4-ethylsulfanyl-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-4-ethylsulfanyl-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 18631885 |
| Molecular Formula | C22H28O2S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (8R,9S,10R,13S,14S)-4-ethylsulfanyl-10,13-dimethyl-6-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C(SCC)=C12 |
| InChI | InChI=1S/C22H28O2S/c1-5-25-20-17(23)9-11-22(4)16-8-10-21(3)15(6-7-18(21)24)14(16)12-13(2)19(20)22/h9,11,14-16H,2,5-8,10,12H2,1,3-4H3/t14-,15-,16-,21-,22+/m0/s1 |
| InChIKey | ZJVWIAIAEYGXHV-XJFFXYRESA-N |
| XLogP | 5.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |