C26H27FO4 — CID 70501789
[(8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-oxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 70501789) has the molecular formula C26H27FO4 and a molecular weight of 422.50 g/mol. Its IUPAC name is [(8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-oxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-oxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 70501789 |
| Molecular Formula | C26H27FO4 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-oxo-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12C=CC(OC(=O)c3ccccc3)=CC1=CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)C[C@H](O)C12F |
| InChI | InChI=1S/C26H27FO4/c1-24-15-22(29)26(27)20(19(24)10-11-21(24)28)9-8-17-14-18(12-13-25(17,26)2)31-23(30)16-6-4-3-5-7-16/h3-8,12-14,19-20,22,29H,9-11,15H2,1-2H3/t19-,20-,22-,24-,25-,26?/m0/s1 |
| InChIKey | ANXNXKWVTZYJED-LHXQQFBUSA-N |
| XLogP | 4.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |