C26H37FO8 — CID 22806280
(2S,8R,11S,12S,14R,15S,16S,18S)-1-fluoro-14,15,18-trihydroxy-2,16-dimethyl-15-[2-(oxan-2-yloxy)acetyl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one (PubChem CID 22806280) has the molecular formula C26H37FO8 and a molecular weight of 496.57 g/mol. Its IUPAC name is (2S,8R,11S,12S,14R,15S,16S,18S)-1-fluoro-14,15,18-trihydroxy-2,16-dimethyl-15-[2-(oxan-2-yloxy)acetyl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one.
| Compound Name | (2S,8R,11S,12S,14R,15S,16S,18S)-1-fluoro-14,15,18-trihydroxy-2,16-dimethyl-15-[2-(oxan-2-yloxy)acetyl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one |
|---|---|
| PubChem CID | 22806280 |
| Molecular Formula | C26H37FO8 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (2S,8R,11S,12S,14R,15S,16S,18S)-1-fluoro-14,15,18-trihydroxy-2,16-dimethyl-15-[2-(oxan-2-yloxy)acetyl]-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-5-one |
| SMILES | C[C@]12C[C@H](O)C3(F)[C@@H](CC[C@]45OC4C(=O)CC[C@]35C)[C@@H]1C[C@@H](O)[C@]2(O)C(=O)COC1CCCCO1 |
| InChI | InChI=1S/C26H37FO8/c1-22-12-18(30)25(27)14(6-9-24-21(35-24)16(28)7-8-23(24,25)2)15(22)11-17(29)26(22,32)19(31)13-34-20-5-3-4-10-33-20/h14-15,17-18,20-21,29-30,32H,3-13H2,1-2H3/t14-,15-,17+,18-,20?,21?,22-,23-,24-,25?,26-/m0/s1 |
| InChIKey | LTGACCRKPMJZDI-VEKQIICRSA-N |
| XLogP | 1.61 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|