C22H34O3 — CID 124911023
(5R,8S,9R,10R,13R,14R)-5,10,13-trimethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one (PubChem CID 124911023) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (5R,8S,9R,10R,13R,14R)-5,10,13-trimethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one.
| Compound Name | (5R,8S,9R,10R,13R,14R)-5,10,13-trimethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
|---|---|
| PubChem CID | 124911023 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (5R,8S,9R,10R,13R,14R)-5,10,13-trimethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
| SMILES | C[C@]12CC[C@@H]3[C@H]4CCC(=O)[C@]4(C)CC[C@H]3[C@@]1(C)CCC1(C2)OCCO1 |
| InChI | InChI=1S/C22H34O3/c1-19-8-6-15-16-4-5-18(23)20(16,2)9-7-17(15)21(19,3)10-11-22(14-19)24-12-13-25-22/h15-17H,4-14H2,1-3H3/t15-,16-,17-,19-,20-,21-/m1/s1 |
| InChIKey | GOQSFMJREPWSEI-ZAWDRSOMSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |