C22H31FO2 — CID 72585633
17-(1-fluoro-2-hydroxyethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 72585633) has the molecular formula C22H31FO2 and a molecular weight of 346.49 g/mol. Its IUPAC name is 17-(1-fluoro-2-hydroxyethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(1-fluoro-2-hydroxyethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 72585633 |
| Molecular Formula | C22H31FO2 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 17-(1-fluoro-2-hydroxyethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C2CCC3C4CCC(=C(F)CO)C4(C)CCC3C2(C)CCC1=O |
| InChI | InChI=1S/C22H31FO2/c1-13-15-5-4-14-16-6-7-18(19(23)12-24)22(16,3)10-8-17(14)21(15,2)11-9-20(13)25/h14,16-17,24H,4-12H2,1-3H3 |
| InChIKey | OJKJKHFKWSLRDB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |