C18H27NO2 — CID 54226140
(3aS,3bR,9aR,9bS,11aS)-6-amino-9a,11a-dimethyl-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-naphtho[2,1-e][1]benzofuran-7-one (PubChem CID 54226140) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bS,11aS)-6-amino-9a,11a-dimethyl-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-naphtho[2,1-e][1]benzofuran-7-one.
| Compound Name | (3aS,3bR,9aR,9bS,11aS)-6-amino-9a,11a-dimethyl-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-naphtho[2,1-e][1]benzofuran-7-one |
|---|---|
| PubChem CID | 54226140 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (3aS,3bR,9aR,9bS,11aS)-6-amino-9a,11a-dimethyl-3,3a,3b,4,5,8,9,9b,10,11-decahydro-2H-naphtho[2,1-e][1]benzofuran-7-one |
| SMILES | C[C@]12CCC(=O)C(N)=C1CC[C@@H]1[C@@H]2CC[C@]2(C)OCC[C@@H]12 |
| InChI | InChI=1S/C18H27NO2/c1-17-8-6-15(20)16(19)14(17)4-3-11-12(17)5-9-18(2)13(11)7-10-21-18/h11-13H,3-10,19H2,1-2H3/t11-,12+,13+,17-,18+/m1/s1 |
| InChIKey | QFZJBQRMEHOSSL-VQOQZMAISA-N |
| XLogP | 3.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |