C25H35FO3 — CID 70178305
ethyl 2-[(8R,9S,10R,13S,14S)-4-ethyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate (PubChem CID 70178305) has the molecular formula C25H35FO3 and a molecular weight of 402.55 g/mol. Its IUPAC name is ethyl 2-[(8R,9S,10R,13S,14S)-4-ethyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate.
| Compound Name | ethyl 2-[(8R,9S,10R,13S,14S)-4-ethyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate |
|---|---|
| PubChem CID | 70178305 |
| Molecular Formula | C25H35FO3 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | ethyl 2-[(8R,9S,10R,13S,14S)-4-ethyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)=C1CC[C@H]2[C@@H]3CCC4=C(CC)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H35FO3/c1-5-15-17-8-7-16-18-9-10-20(22(26)23(28)29-6-2)25(18,4)13-11-19(16)24(17,3)14-12-21(15)27/h16,18-19H,5-14H2,1-4H3/t16-,18-,19-,24-,25-/m0/s1 |
| InChIKey | UQQFWLFJQHZIOM-SLIXWJGUSA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|