C22H31FO — CID 91022633
(10R,13S)-17-(1-fluoroethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 91022633) has the molecular formula C22H31FO and a molecular weight of 330.49 g/mol. Its IUPAC name is (10R,13S)-17-(1-fluoroethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S)-17-(1-fluoroethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91022633 |
| Molecular Formula | C22H31FO |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (10R,13S)-17-(1-fluoroethylidene)-4,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(F)=C1CCC2C3CCC4=C(C)C(=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C22H31FO/c1-13-16-6-5-15-18-8-7-17(14(2)23)22(18,4)11-9-19(15)21(16,3)12-10-20(13)24/h15,18-19H,5-12H2,1-4H3/t15?,18?,19?,21-,22+/m0/s1 |
| InChIKey | KGHALMJTWVTAJL-DLIZSMLGSA-N |
| XLogP | 6.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |