C25H38N2O2 — CID 67766911
(8S,9S,10R,13S,14S,17S)-4-amino-10,13-dimethyl-17-(piperidine-1-carbonyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67766911) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-4-amino-10,13-dimethyl-17-(piperidine-1-carbonyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-4-amino-10,13-dimethyl-17-(piperidine-1-carbonyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67766911 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-4-amino-10,13-dimethyl-17-(piperidine-1-carbonyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C(N)C(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H38N2O2/c1-24-13-11-21(28)22(26)19(24)7-6-16-17-8-9-20(25(17,2)12-10-18(16)24)23(29)27-14-4-3-5-15-27/h16-18,20H,3-15,26H2,1-2H3/t16-,17-,18-,20+,24+,25-/m0/s1 |
| InChIKey | OHGJVFUKRHXLPE-TZOPLZBGSA-N |
| XLogP | 4.43 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |