C21H26O3 — CID 88760253
(8R,9S,10R,13S,14S)-4-hydroxy-13-methyl-10-propa-1,2-dienyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 88760253) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-4-hydroxy-13-methyl-10-propa-1,2-dienyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-4-hydroxy-13-methyl-10-propa-1,2-dienyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 88760253 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (8R,9S,10R,13S,14S)-4-hydroxy-13-methyl-10-propa-1,2-dienyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C=C[C@]12CCC(=O)C(O)=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H26O3/c1-3-10-21-12-9-17(22)19(24)16(21)5-4-13-14-6-7-18(23)20(14,2)11-8-15(13)21/h10,13-15,24H,1,4-9,11-12H2,2H3/t13-,14-,15-,20-,21+/m0/s1 |
| InChIKey | FSLBOEUYIIMJEQ-DZFIUHNSSA-N |
| XLogP | 4.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |