C25H38O3 — CID 14234175
(8R,9S,10R,13S,14S,15S)-15-hexyl-4-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 14234175) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,15S)-15-hexyl-4-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S,15S)-15-hexyl-4-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 14234175 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (8R,9S,10R,13S,14S,15S)-15-hexyl-4-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CCCCCC[C@H]1CC(=O)[C@@]2(C)CC[C@H]3[C@@H](CCC4=C(O)C(=O)CC[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C25H38O3/c1-4-5-6-7-8-16-15-21(27)25(3)13-11-18-17(22(16)25)9-10-19-23(28)20(26)12-14-24(18,19)2/h16-18,22,28H,4-15H2,1-3H3/t16-,17+,18-,22-,24+,25+/m0/s1 |
| InChIKey | WNSYJYQZOLSMFX-CFSYWCJFSA-N |
| XLogP | 6.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|