C23H33NO3 — CID 14234203
N-[(8R,9S,10R,13S,14S,15S)-15-ethyl-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide (PubChem CID 14234203) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is N-[(8R,9S,10R,13S,14S,15S)-15-ethyl-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide.
| Compound Name | N-[(8R,9S,10R,13S,14S,15S)-15-ethyl-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide |
|---|---|
| PubChem CID | 14234203 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | N-[(8R,9S,10R,13S,14S,15S)-15-ethyl-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide |
| SMILES | CC[C@H]1CC(=O)[C@@]2(C)CC[C@H]3[C@@H](CCC4=C(NC(C)=O)C(=O)CC[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C23H33NO3/c1-5-14-12-19(27)23(4)10-8-16-15(20(14)23)6-7-17-21(24-13(2)25)18(26)9-11-22(16,17)3/h14-16,20H,5-12H2,1-4H3,(H,24,25)/t14-,15+,16-,20-,22+,23+/m0/s1 |
| InChIKey | AFHYYNFRSWKTCM-HVXMTFNESA-N |
| XLogP | 4.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |