C25H31NO3 — CID 54152025
N-[(8R,9S,10R,13S,14S)-7-but-3-ynyl-10,13-dimethyl-3,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide (PubChem CID 54152025) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[(8R,9S,10R,13S,14S)-7-but-3-ynyl-10,13-dimethyl-3,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide.
| Compound Name | N-[(8R,9S,10R,13S,14S)-7-but-3-ynyl-10,13-dimethyl-3,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide |
|---|---|
| PubChem CID | 54152025 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[(8R,9S,10R,13S,14S)-7-but-3-ynyl-10,13-dimethyl-3,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-4-yl]acetamide |
| SMILES | C#CCCC1=CC2=C(NC(C)=O)C(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H31NO3/c1-5-6-7-16-14-19-23(26-15(2)27)20(28)11-13-24(19,3)18-10-12-25(4)17(22(16)18)8-9-21(25)29/h1,14,17-18,22H,6-13H2,2-4H3,(H,26,27)/t17-,18-,22-,24+,25-/m0/s1 |
| InChIKey | OIKIBHIBGJHMMB-GLQNRZCPSA-N |
| XLogP | 4.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|