C20H24O4 — CID 91568869
methyl (8R,13S,14S)-13-methyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate (PubChem CID 91568869) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl (8R,13S,14S)-13-methyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate.
| Compound Name | methyl (8R,13S,14S)-13-methyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate |
|---|---|
| PubChem CID | 91568869 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | methyl (8R,13S,14S)-13-methyl-3,17-dioxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-7-carboxylate |
| SMILES | COC(=O)C1CC2=CC(=O)CCC2=C2CC[C@]3(C)C(=O)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C20H24O4/c1-20-8-7-14-13-4-3-12(21)9-11(13)10-15(19(23)24-2)18(14)16(20)5-6-17(20)22/h9,15-16,18H,3-8,10H2,1-2H3/t15?,16-,18-,20-/m0/s1 |
| InChIKey | XQJUWPYLCWUTCK-FYWFPHAESA-N |
| XLogP | 3.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |