C19H22O2 — CID 57154607
(1R,2R,4R,7S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-10,15-diene-6,14-dione (PubChem CID 57154607) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,2R,4R,7S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-10,15-diene-6,14-dione.
| Compound Name | (1R,2R,4R,7S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-10,15-diene-6,14-dione |
|---|---|
| PubChem CID | 57154607 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (1R,2R,4R,7S)-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-10,15-diene-6,14-dione |
| SMILES | C[C@]12CCC3=C4CCC(=O)C=C4CC[C@H]3[C@]13C[C@@H]3CC2=O |
| InChI | InChI=1S/C19H22O2/c1-18-7-6-15-14-4-3-13(20)8-11(14)2-5-16(15)19(18)10-12(19)9-17(18)21/h8,12,16H,2-7,9-10H2,1H3/t12-,16+,18+,19+/m0/s1 |
| InChIKey | PTKKVGKOQXICDJ-ZLKDORHNSA-N |
| XLogP | 3.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |