C21H30O2 — CID 56633152
(7R,8S,13S,14S)-7-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 56633152) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (7R,8S,13S,14S)-7-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8S,13S,14S)-7-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56633152 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (7R,8S,13S,14S)-7-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@H]1C(=C3CCC(=O)C=C3C[C@H]1CCCO)CC2 |
| InChI | InChI=1S/C21H30O2/c1-21-9-2-5-19(21)20-14(4-3-11-22)12-15-13-16(23)6-7-17(15)18(20)8-10-21/h13-14,19-20,22H,2-12H2,1H3/t14-,19+,20-,21+/m1/s1 |
| InChIKey | ACMXBXZSNDJDMD-ZQEFQCJFSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |