C19H25BrO2 — CID 91054757
(1R,7S,10S,11R)-15-bromo-6-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one (PubChem CID 91054757) has the molecular formula C19H25BrO2 and a molecular weight of 365.31 g/mol. Its IUPAC name is (1R,7S,10S,11R)-15-bromo-6-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one.
| Compound Name | (1R,7S,10S,11R)-15-bromo-6-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
|---|---|
| PubChem CID | 91054757 |
| Molecular Formula | C19H25BrO2 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (1R,7S,10S,11R)-15-bromo-6-hydroxy-7-methylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C(Br)C(=O)CC[C@@H]43)C13CC3CC2O |
| InChI | InChI=1S/C19H25BrO2/c1-18-7-6-12-11-3-5-15(21)17(20)13(11)2-4-14(12)19(18)9-10(19)8-16(18)22/h10-12,14,16,22H,2-9H2,1H3/t10?,11-,12-,14-,16?,18-,19?/m1/s1 |
| InChIKey | WOCMVKQFPUVIJT-MHENCCHYSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|