C21H26BrF5O2 — CID 90850558
(8R,9S,10R,14S)-4-bromo-13-(3,3,4,4,4-pentafluoro-1-hydroxybutan-2-yl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 90850558) has the molecular formula C21H26BrF5O2 and a molecular weight of 485.33 g/mol. Its IUPAC name is (8R,9S,10R,14S)-4-bromo-13-(3,3,4,4,4-pentafluoro-1-hydroxybutan-2-yl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,14S)-4-bromo-13-(3,3,4,4,4-pentafluoro-1-hydroxybutan-2-yl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 90850558 |
| Molecular Formula | C21H26BrF5O2 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (8R,9S,10R,14S)-4-bromo-13-(3,3,4,4,4-pentafluoro-1-hydroxybutan-2-yl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | O=C1CC[C@H]2C(=C1Br)CC[C@@H]1[C@@H]2CCC2(C(CO)C(F)(F)C(F)(F)F)CCC[C@@H]12 |
| InChI | InChI=1S/C21H26BrF5O2/c22-18-14-4-3-13-12(11(14)5-6-16(18)29)7-9-19(8-1-2-15(13)19)17(10-28)20(23,24)21(25,26)27/h11-13,15,17,28H,1-10H2/t11-,12-,13-,15+,17?,19?/m1/s1 |
| InChIKey | IIDQRNWLQKPCQQ-GSGQHCLMSA-N |
| XLogP | 6.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|